C21H24Cl3N3O2 — CID 30635620
(2R)-2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 30635620) has the molecular formula C21H24Cl3N3O2 and a molecular weight of 456.80 g/mol. Its IUPAC name is (2R)-2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 30635620 |
| Molecular Formula | C21H24Cl3N3O2 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | (2R)-2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cc(Cl)c(Cl)cc1Cl)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24Cl3N3O2/c1-15(21(28)25-20-14-18(23)17(22)13-19(20)24)27-9-7-26(8-10-27)11-12-29-16-5-3-2-4-6-16/h2-6,13-15H,7-12H2,1H3,(H,25,28)/t15-/m1/s1 |
| InChIKey | MWNVIPLKQHYKNY-OAHLLOKOSA-N |
| XLogP | 4.67 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|