C27H31N3O2S — CID 55432351
2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2-phenylsulfanylphenyl)propanamide (PubChem CID 55432351) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is 2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2-phenylsulfanylphenyl)propanamide.
| Compound Name | 2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2-phenylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 55432351 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2-phenylsulfanylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccccc1Sc1ccccc1)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O2S/c1-22(30-18-16-29(17-19-30)20-21-32-23-10-4-2-5-11-23)27(31)28-25-14-8-9-15-26(25)33-24-12-6-3-7-13-24/h2-15,22H,16-21H2,1H3,(H,28,31) |
| InChIKey | GDDORQFMLHBLDQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |