C24H33N3O2 — CID 84965791
2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 84965791) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 84965791 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[4-(2-phenoxyethyl)piperazin-1-yl]-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)N2CCN(CCOc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C24H33N3O2/c1-18-16-19(2)23(20(3)17-18)25-24(28)21(4)27-12-10-26(11-13-27)14-15-29-22-8-6-5-7-9-22/h5-9,16-17,21H,10-15H2,1-4H3,(H,25,28) |
| InChIKey | FDUAZRXYRJGJLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |