C21H21Cl3N4O — CID 55355629
2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 55355629) has the molecular formula C21H21Cl3N4O and a molecular weight of 451.79 g/mol. Its IUPAC name is 2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 55355629 |
| Molecular Formula | C21H21Cl3N4O |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)c(Cl)cc1Cl)N1CCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C21H21Cl3N4O/c1-14(21(29)26-20-11-18(23)17(22)10-19(20)24)28-8-6-27(7-9-28)13-16-4-2-15(12-25)3-5-16/h2-5,10-11,14H,6-9,13H2,1H3,(H,26,29) |
| InChIKey | HBHMUDRWWLIWRM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|