C21H23ClN4O — CID 9389720
(2R)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(3-cyanophenyl)propanamide (PubChem CID 9389720) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is (2R)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(3-cyanophenyl)propanamide.
| Compound Name | (2R)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(3-cyanophenyl)propanamide |
|---|---|
| PubChem CID | 9389720 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (2R)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(3-cyanophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(C#N)c1)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H23ClN4O/c1-16(21(27)24-20-4-2-3-18(13-20)14-23)26-11-9-25(10-12-26)15-17-5-7-19(22)8-6-17/h2-8,13,16H,9-12,15H2,1H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | IHNVCFLMIOKWBH-MRXNPFEDSA-N |
| XLogP | 3.36 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |