C20H31N3O2 — CID 78786222
N-cyclohexyl-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylpropanamide (PubChem CID 78786222) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylpropanamide.
| Compound Name | N-cyclohexyl-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 78786222 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-cyclohexyl-2-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylpropanamide |
| SMILES | CC(C(=O)N(C)C1CCCCC1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-16(20(25)21(2)17-8-4-3-5-9-17)22-12-14-23(15-13-22)18-10-6-7-11-19(18)24/h6-7,10-11,16-17,24H,3-5,8-9,12-15H2,1-2H3 |
| InChIKey | URBWQUHIFUVLMG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |