C24H38N4O2 — CID 30622887
(2S)-N-cyclohexyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]-N-methylpropanamide (PubChem CID 30622887) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]-N-methylpropanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 30622887 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[4-[2-(2-ethylanilino)-2-oxoethyl]piperazin-1-yl]-N-methylpropanamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN([C@@H](C)C(=O)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H38N4O2/c1-4-20-10-8-9-13-22(20)25-23(29)18-27-14-16-28(17-15-27)19(2)24(30)26(3)21-11-6-5-7-12-21/h8-10,13,19,21H,4-7,11-12,14-18H2,1-3H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | ZQCVTDUNDQDSQA-IBGZPJMESA-N |
| XLogP | 2.98 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |