C19H27N3O5S — CID 47094628
4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)ethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 47094628) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)ethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)ethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 47094628 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)ethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCN2C(=O)NC3(CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H27N3O5S/c1-21(2)28(25,26)16-9-7-15(8-10-16)27-14-13-22-17(23)19(20-18(22)24)11-5-3-4-6-12-19/h7-10H,3-6,11-14H2,1-2H3,(H,20,24) |
| InChIKey | MXTWJAJPVVEUFV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|