C20H21Cl2N3O5S — CID 24556959
4-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 24556959) has the molecular formula C20H21Cl2N3O5S and a molecular weight of 486.38 g/mol. Its IUPAC name is 4-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24556959 |
| Molecular Formula | C20H21Cl2N3O5S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 4-[2-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCN2C(=O)NC(C)(c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O5S/c1-20(16-9-4-13(21)12-17(16)22)18(26)25(19(27)23-20)10-11-30-14-5-7-15(8-6-14)31(28,29)24(2)3/h4-9,12H,10-11H2,1-3H3,(H,23,27) |
| InChIKey | NBACVNBGOQQWKF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|