C18H15Cl3N2O3 — CID 4025204
5-(4-chlorophenyl)-3-[2-(2,4-dichlorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 4025204) has the molecular formula C18H15Cl3N2O3 and a molecular weight of 413.69 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[2-(2,4-dichlorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[2-(2,4-dichlorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4025204 |
| Molecular Formula | C18H15Cl3N2O3 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[2-(2,4-dichlorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)cc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H15Cl3N2O3/c1-18(11-2-4-12(19)5-3-11)16(24)23(17(25)22-18)8-9-26-15-7-6-13(20)10-14(15)21/h2-7,10H,8-9H2,1H3,(H,22,25) |
| InChIKey | JTQMVNQWMNXPMY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|