C16H14Cl2N2O3S — CID 60617438
3-[2-(2,4-dichlorophenoxy)ethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 60617438) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60617438 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccsc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-16(10-4-7-24-9-10)14(21)20(15(22)19-16)5-6-23-13-3-2-11(17)8-12(13)18/h2-4,7-9H,5-6H2,1H3,(H,19,22) |
| InChIKey | ZVAHKSLAGWRSLP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|