C17H19ClN2O4S — CID 16606995
(2-chloroquinolin-3-yl)methyl 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 16606995) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | (2-chloroquinolin-3-yl)methyl 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 16606995 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CS(=O)(=O)N1CCC(C(=O)OCc2cc3ccccc3nc2Cl)CC1 |
| InChI | InChI=1S/C17H19ClN2O4S/c1-25(22,23)20-8-6-12(7-9-20)17(21)24-11-14-10-13-4-2-3-5-15(13)19-16(14)18/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | ROHKMSQTPZIMDU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|