C24H25N3O5S — CID 25497624
(3-methylquinoxalin-2-yl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 25497624) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is (3-methylquinoxalin-2-yl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3-methylquinoxalin-2-yl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 25497624 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (3-methylquinoxalin-2-yl)methyl 1-(4-acetylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)OCc3nc4ccccc4nc3C)CC2)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-16-23(26-22-6-4-3-5-21(22)25-16)15-32-24(29)19-11-13-27(14-12-19)33(30,31)20-9-7-18(8-10-20)17(2)28/h3-10,19H,11-15H2,1-2H3 |
| InChIKey | PLLAGFQSMVCZCP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |