C22H22N2O3S — CID 55623363
1,3-benzothiazol-2-ylmethyl 1-(4-methylbenzoyl)piperidine-3-carboxylate (PubChem CID 55623363) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 1-(4-methylbenzoyl)piperidine-3-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 1-(4-methylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55623363 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 1-(4-methylbenzoyl)piperidine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)OCc3nc4ccccc4s3)C2)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-15-8-10-16(11-9-15)21(25)24-12-4-5-17(13-24)22(26)27-14-20-23-18-6-2-3-7-19(18)28-20/h2-3,6-11,17H,4-5,12-14H2,1H3 |
| InChIKey | IDEVPKQQOCNORU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |