About propyl 3-cyclopentylpropanoate
propyl 3-cyclopentylpropanoate (PubChem CID 43389546) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is propyl 3-cyclopentylpropanoate.
Molecular Properties
| Compound Name | propyl 3-cyclopentylpropanoate |
| PubChem CID | 43389546 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | propyl 3-cyclopentylpropanoate |
| SMILES | CCCOC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C11H20O2/c1-2-9-13-11(12)8-7-10-5-3-4-6-10/h10H,2-9H2,1H3 |
| InChIKey | DONVPVJCEGSTHD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propyl 3-cyclopentylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-cyclopentylpropanoate?
The IUPAC name of propyl 3-cyclopentylpropanoate (CID 43389546) is propyl 3-cyclopentylpropanoate.
What is the SMILES notation for propyl 3-cyclopentylpropanoate?
The canonical SMILES for propyl 3-cyclopentylpropanoate is CCCOC(=O)CCC1CCCC1.
What is the InChIKey of propyl 3-cyclopentylpropanoate?
The InChIKey is DONVPVJCEGSTHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-2-9-13-11(12)8-7-10-5-3-4-6-10/h10H,2-9H2,1H3.
What are the key properties of propyl 3-cyclopentylpropanoate?
propyl 3-cyclopentylpropanoate has a molecular weight of 184.28 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-cyclopentylpropanoate is sourced from PubChem (CID 43389546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).