About 2-ethylhexyl 3-cyclopentylpropanoate
2-ethylhexyl 3-cyclopentylpropanoate (PubChem CID 543877) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-ethylhexyl 3-cyclopentylpropanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 3-cyclopentylpropanoate |
| PubChem CID | 543877 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-ethylhexyl 3-cyclopentylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C16H30O2/c1-3-5-8-14(4-2)13-18-16(17)12-11-15-9-6-7-10-15/h14-15H,3-13H2,1-2H3 |
| InChIKey | YYJAOOCQAQLWFR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexyl 3-cyclopentylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 3-cyclopentylpropanoate?
The IUPAC name of 2-ethylhexyl 3-cyclopentylpropanoate (CID 543877) is 2-ethylhexyl 3-cyclopentylpropanoate.
What is the SMILES notation for 2-ethylhexyl 3-cyclopentylpropanoate?
The canonical SMILES for 2-ethylhexyl 3-cyclopentylpropanoate is CCCCC(CC)COC(=O)CCC1CCCC1.
What is the InChIKey of 2-ethylhexyl 3-cyclopentylpropanoate?
The InChIKey is YYJAOOCQAQLWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-3-5-8-14(4-2)13-18-16(17)12-11-15-9-6-7-10-15/h14-15H,3-13H2,1-2H3.
What are the key properties of 2-ethylhexyl 3-cyclopentylpropanoate?
2-ethylhexyl 3-cyclopentylpropanoate has a molecular weight of 254.41 g/mol, XLogP of 4.72, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 3-cyclopentylpropanoate is sourced from PubChem (CID 543877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).