About prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate
prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate (PubChem CID 157403985) has the molecular formula C22H38O4
and a molecular weight of 366.54 g/mol. Its IUPAC name is prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate.
Molecular Properties
| Compound Name | prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate |
| PubChem CID | 157403985 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate |
| SMILES | C=CCOC(=O)CCC1CCCCC1.C=CCOC(=O)CCCCCC |
| InChI | InChI=1S/C12H20O2.C10H18O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11;1-3-5-6-7-8-10(11)12-9-4-2/h2,11H,1,3-10H2;4H,2-3,5-9H2,1H3 |
| InChIKey | BNMPNBCTSBGKFE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate?
The IUPAC name of prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate (CID 157403985) is prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate.
What is the SMILES notation for prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate?
The canonical SMILES for prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate is C=CCOC(=O)CCC1CCCCC1.C=CCOC(=O)CCCCCC.
What is the InChIKey of prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate?
The InChIKey is BNMPNBCTSBGKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.C10H18O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11;1-3-5-6-7-8-10(11)12-9-4-2/h2,11H,1,3-10H2;4H,2-3,5-9H2,1H3.
What are the key properties of prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate?
prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate has a molecular weight of 366.54 g/mol, XLogP of 5.76, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-cyclohexylpropanoate;prop-2-enyl heptanoate is sourced from PubChem (CID 157403985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).