About 2-cyclopentylethyl butanoate
2-cyclopentylethyl butanoate (PubChem CID 142409115) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-cyclopentylethyl butanoate.
Molecular Properties
| Compound Name | 2-cyclopentylethyl butanoate |
| PubChem CID | 142409115 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-cyclopentylethyl butanoate |
| SMILES | CCCC(=O)OCCC1CCCC1 |
| InChI | InChI=1S/C11H20O2/c1-2-5-11(12)13-9-8-10-6-3-4-7-10/h10H,2-9H2,1H3 |
| InChIKey | OVMAUSNFQXKGJK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopentylethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylethyl butanoate?
The IUPAC name of 2-cyclopentylethyl butanoate (CID 142409115) is 2-cyclopentylethyl butanoate.
What is the SMILES notation for 2-cyclopentylethyl butanoate?
The canonical SMILES for 2-cyclopentylethyl butanoate is CCCC(=O)OCCC1CCCC1.
What is the InChIKey of 2-cyclopentylethyl butanoate?
The InChIKey is OVMAUSNFQXKGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-2-5-11(12)13-9-8-10-6-3-4-7-10/h10H,2-9H2,1H3.
What are the key properties of 2-cyclopentylethyl butanoate?
2-cyclopentylethyl butanoate has a molecular weight of 184.28 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylethyl butanoate is sourced from PubChem (CID 142409115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).