About 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate
1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate (PubChem CID 91704743) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate.
Molecular Properties
| Compound Name | 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate |
| PubChem CID | 91704743 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate |
| SMILES | CC(C)COC(=O)CCC(=O)OCCC1CCCCC1 |
| InChI | InChI=1S/C16H28O4/c1-13(2)12-20-16(18)9-8-15(17)19-11-10-14-6-4-3-5-7-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | CTCLNKAKUZKSNP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate?
The IUPAC name of 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate (CID 91704743) is 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate.
What is the SMILES notation for 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate?
The canonical SMILES for 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate is CC(C)COC(=O)CCC(=O)OCCC1CCCCC1.
What is the InChIKey of 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate?
The InChIKey is CTCLNKAKUZKSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-13(2)12-20-16(18)9-8-15(17)19-11-10-14-6-4-3-5-7-14/h13-14H,3-12H2,1-2H3.
What are the key properties of 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate?
1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate has a molecular weight of 284.40 g/mol, XLogP of 3.48, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-cyclohexylethyl) 4-O-(2-methylpropyl) butanedioate is sourced from PubChem (CID 91704743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).