About 2-cyclohexylethyl 2-hydroxyacetate
2-cyclohexylethyl 2-hydroxyacetate (PubChem CID 67340221) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-cyclohexylethyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | 2-cyclohexylethyl 2-hydroxyacetate |
| PubChem CID | 67340221 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-cyclohexylethyl 2-hydroxyacetate |
| SMILES | O=C(CO)OCCC1CCCCC1 |
| InChI | InChI=1S/C10H18O3/c11-8-10(12)13-7-6-9-4-2-1-3-5-9/h9,11H,1-8H2 |
| InChIKey | OCGBTESGWIBHCB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexylethyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylethyl 2-hydroxyacetate?
The IUPAC name of 2-cyclohexylethyl 2-hydroxyacetate (CID 67340221) is 2-cyclohexylethyl 2-hydroxyacetate.
What is the SMILES notation for 2-cyclohexylethyl 2-hydroxyacetate?
The canonical SMILES for 2-cyclohexylethyl 2-hydroxyacetate is O=C(CO)OCCC1CCCCC1.
What is the InChIKey of 2-cyclohexylethyl 2-hydroxyacetate?
The InChIKey is OCGBTESGWIBHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c11-8-10(12)13-7-6-9-4-2-1-3-5-9/h9,11H,1-8H2.
What are the key properties of 2-cyclohexylethyl 2-hydroxyacetate?
2-cyclohexylethyl 2-hydroxyacetate has a molecular weight of 186.25 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylethyl 2-hydroxyacetate is sourced from PubChem (CID 67340221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).