About 2-cyclopentylethyl methyl carbonate
2-cyclopentylethyl methyl carbonate (PubChem CID 66771150) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-cyclopentylethyl methyl carbonate.
Molecular Properties
| Compound Name | 2-cyclopentylethyl methyl carbonate |
| PubChem CID | 66771150 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-cyclopentylethyl methyl carbonate |
| SMILES | COC(=O)OCCC1CCCC1 |
| InChI | InChI=1S/C9H16O3/c1-11-9(10)12-7-6-8-4-2-3-5-8/h8H,2-7H2,1H3 |
| InChIKey | QZRGELVEGKZGSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentylethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylethyl methyl carbonate?
The IUPAC name of 2-cyclopentylethyl methyl carbonate (CID 66771150) is 2-cyclopentylethyl methyl carbonate.
What is the SMILES notation for 2-cyclopentylethyl methyl carbonate?
The canonical SMILES for 2-cyclopentylethyl methyl carbonate is COC(=O)OCCC1CCCC1.
What is the InChIKey of 2-cyclopentylethyl methyl carbonate?
The InChIKey is QZRGELVEGKZGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-11-9(10)12-7-6-8-4-2-3-5-8/h8H,2-7H2,1H3.
What are the key properties of 2-cyclopentylethyl methyl carbonate?
2-cyclopentylethyl methyl carbonate has a molecular weight of 172.22 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylethyl methyl carbonate is sourced from PubChem (CID 66771150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).