About 2-cyclohexylethyl 2-aminoacetate
2-cyclohexylethyl 2-aminoacetate (PubChem CID 54016535) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-cyclohexylethyl 2-aminoacetate.
Molecular Properties
| Compound Name | 2-cyclohexylethyl 2-aminoacetate |
| PubChem CID | 54016535 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-cyclohexylethyl 2-aminoacetate |
| SMILES | NCC(=O)OCCC1CCCCC1 |
| InChI | InChI=1S/C10H19NO2/c11-8-10(12)13-7-6-9-4-2-1-3-5-9/h9H,1-8,11H2 |
| InChIKey | QZHGBBADSBTTLG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexylethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylethyl 2-aminoacetate?
The IUPAC name of 2-cyclohexylethyl 2-aminoacetate (CID 54016535) is 2-cyclohexylethyl 2-aminoacetate.
What is the SMILES notation for 2-cyclohexylethyl 2-aminoacetate?
The canonical SMILES for 2-cyclohexylethyl 2-aminoacetate is NCC(=O)OCCC1CCCCC1.
What is the InChIKey of 2-cyclohexylethyl 2-aminoacetate?
The InChIKey is QZHGBBADSBTTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c11-8-10(12)13-7-6-9-4-2-1-3-5-9/h9H,1-8,11H2.
What are the key properties of 2-cyclohexylethyl 2-aminoacetate?
2-cyclohexylethyl 2-aminoacetate has a molecular weight of 185.27 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylethyl 2-aminoacetate is sourced from PubChem (CID 54016535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).