About 4-cycloheptylbutyl butanoate
4-cycloheptylbutyl butanoate (PubChem CID 54174835) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 4-cycloheptylbutyl butanoate.
Molecular Properties
| Compound Name | 4-cycloheptylbutyl butanoate |
| PubChem CID | 54174835 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 4-cycloheptylbutyl butanoate |
| SMILES | CCCC(=O)OCCCCC1CCCCCC1 |
| InChI | InChI=1S/C15H28O2/c1-2-9-15(16)17-13-8-7-12-14-10-5-3-4-6-11-14/h14H,2-13H2,1H3 |
| InChIKey | BCTYQQURLGANBX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cycloheptylbutyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cycloheptylbutyl butanoate?
The IUPAC name of 4-cycloheptylbutyl butanoate (CID 54174835) is 4-cycloheptylbutyl butanoate.
What is the SMILES notation for 4-cycloheptylbutyl butanoate?
The canonical SMILES for 4-cycloheptylbutyl butanoate is CCCC(=O)OCCCCC1CCCCCC1.
What is the InChIKey of 4-cycloheptylbutyl butanoate?
The InChIKey is BCTYQQURLGANBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-2-9-15(16)17-13-8-7-12-14-10-5-3-4-6-11-14/h14H,2-13H2,1H3.
What are the key properties of 4-cycloheptylbutyl butanoate?
4-cycloheptylbutyl butanoate has a molecular weight of 240.39 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cycloheptylbutyl butanoate is sourced from PubChem (CID 54174835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).