About 8-cyclohexyloctan-4-one
8-cyclohexyloctan-4-one (PubChem CID 143863986) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 8-cyclohexyloctan-4-one.
Molecular Properties
| Compound Name | 8-cyclohexyloctan-4-one |
| PubChem CID | 143863986 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 8-cyclohexyloctan-4-one |
| SMILES | CCCC(=O)CCCCC1CCCCC1 |
| InChI | InChI=1S/C14H26O/c1-2-8-14(15)12-7-6-11-13-9-4-3-5-10-13/h13H,2-12H2,1H3 |
| InChIKey | MZZOEEBVRNAAMC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclohexyloctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclohexyloctan-4-one?
The IUPAC name of 8-cyclohexyloctan-4-one (CID 143863986) is 8-cyclohexyloctan-4-one.
What is the SMILES notation for 8-cyclohexyloctan-4-one?
The canonical SMILES for 8-cyclohexyloctan-4-one is CCCC(=O)CCCCC1CCCCC1.
What is the InChIKey of 8-cyclohexyloctan-4-one?
The InChIKey is MZZOEEBVRNAAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-2-8-14(15)12-7-6-11-13-9-4-3-5-10-13/h13H,2-12H2,1H3.
What are the key properties of 8-cyclohexyloctan-4-one?
8-cyclohexyloctan-4-one has a molecular weight of 210.36 g/mol, XLogP of 4.50, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclohexyloctan-4-one is sourced from PubChem (CID 143863986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).