About 2-cyclopentylethyl prop-2-ynoate
2-cyclopentylethyl prop-2-ynoate (PubChem CID 154203049) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-cyclopentylethyl prop-2-ynoate.
Molecular Properties
| Compound Name | 2-cyclopentylethyl prop-2-ynoate |
| PubChem CID | 154203049 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-cyclopentylethyl prop-2-ynoate |
| SMILES | C#CC(=O)OCCC1CCCC1 |
| InChI | InChI=1S/C10H14O2/c1-2-10(11)12-8-7-9-5-3-4-6-9/h1,9H,3-8H2 |
| InChIKey | JAQFZWQDURTWFM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentylethyl prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylethyl prop-2-ynoate?
The IUPAC name of 2-cyclopentylethyl prop-2-ynoate (CID 154203049) is 2-cyclopentylethyl prop-2-ynoate.
What is the SMILES notation for 2-cyclopentylethyl prop-2-ynoate?
The canonical SMILES for 2-cyclopentylethyl prop-2-ynoate is C#CC(=O)OCCC1CCCC1.
What is the InChIKey of 2-cyclopentylethyl prop-2-ynoate?
The InChIKey is JAQFZWQDURTWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-10(11)12-8-7-9-5-3-4-6-9/h1,9H,3-8H2.
What are the key properties of 2-cyclopentylethyl prop-2-ynoate?
2-cyclopentylethyl prop-2-ynoate has a molecular weight of 166.22 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylethyl prop-2-ynoate is sourced from PubChem (CID 154203049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).