About 2-cyclopropylethyl piperidine-1-carboxylate
2-cyclopropylethyl piperidine-1-carboxylate (PubChem CID 142778075) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-cyclopropylethyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-cyclopropylethyl piperidine-1-carboxylate |
| PubChem CID | 142778075 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-cyclopropylethyl piperidine-1-carboxylate |
| SMILES | O=C(OCCC1CC1)N1CCCCC1 |
| InChI | InChI=1S/C11H19NO2/c13-11(12-7-2-1-3-8-12)14-9-6-10-4-5-10/h10H,1-9H2 |
| InChIKey | SBBWCOYMJXKOBH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropylethyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylethyl piperidine-1-carboxylate?
The IUPAC name of 2-cyclopropylethyl piperidine-1-carboxylate (CID 142778075) is 2-cyclopropylethyl piperidine-1-carboxylate.
What is the SMILES notation for 2-cyclopropylethyl piperidine-1-carboxylate?
The canonical SMILES for 2-cyclopropylethyl piperidine-1-carboxylate is O=C(OCCC1CC1)N1CCCCC1.
What is the InChIKey of 2-cyclopropylethyl piperidine-1-carboxylate?
The InChIKey is SBBWCOYMJXKOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c13-11(12-7-2-1-3-8-12)14-9-6-10-4-5-10/h10H,1-9H2.
What are the key properties of 2-cyclopropylethyl piperidine-1-carboxylate?
2-cyclopropylethyl piperidine-1-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylethyl piperidine-1-carboxylate is sourced from PubChem (CID 142778075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).