About (cyclopropylmethylamino) piperidine-1-carboxylate
(cyclopropylmethylamino) piperidine-1-carboxylate (PubChem CID 142606376) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is (cyclopropylmethylamino) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (cyclopropylmethylamino) piperidine-1-carboxylate |
| PubChem CID | 142606376 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (cyclopropylmethylamino) piperidine-1-carboxylate |
| SMILES | O=C(ONCC1CC1)N1CCCCC1 |
| InChI | InChI=1S/C10H18N2O2/c13-10(12-6-2-1-3-7-12)14-11-8-9-4-5-9/h9,11H,1-8H2 |
| InChIKey | AZVYWRZCJXDDDA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyclopropylmethylamino) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclopropylmethylamino) piperidine-1-carboxylate?
The IUPAC name of (cyclopropylmethylamino) piperidine-1-carboxylate (CID 142606376) is (cyclopropylmethylamino) piperidine-1-carboxylate.
What is the SMILES notation for (cyclopropylmethylamino) piperidine-1-carboxylate?
The canonical SMILES for (cyclopropylmethylamino) piperidine-1-carboxylate is O=C(ONCC1CC1)N1CCCCC1.
What is the InChIKey of (cyclopropylmethylamino) piperidine-1-carboxylate?
The InChIKey is AZVYWRZCJXDDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c13-10(12-6-2-1-3-7-12)14-11-8-9-4-5-9/h9,11H,1-8H2.
What are the key properties of (cyclopropylmethylamino) piperidine-1-carboxylate?
(cyclopropylmethylamino) piperidine-1-carboxylate has a molecular weight of 198.27 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclopropylmethylamino) piperidine-1-carboxylate is sourced from PubChem (CID 142606376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).