About prop-2-enyl piperidine-1-carboxylate;hydrochloride
prop-2-enyl piperidine-1-carboxylate;hydrochloride (PubChem CID 139812322) has the molecular formula C9H16ClNO2
and a molecular weight of 205.68 g/mol. Its IUPAC name is prop-2-enyl piperidine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enyl piperidine-1-carboxylate;hydrochloride |
| PubChem CID | 139812322 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | prop-2-enyl piperidine-1-carboxylate;hydrochloride |
| SMILES | C=CCOC(=O)N1CCCCC1.Cl |
| InChI | InChI=1S/C9H15NO2.ClH/c1-2-8-12-9(11)10-6-4-3-5-7-10;/h2H,1,3-8H2;1H |
| InChIKey | VVWMXZJTDHQVSG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl piperidine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl piperidine-1-carboxylate;hydrochloride?
The IUPAC name of prop-2-enyl piperidine-1-carboxylate;hydrochloride (CID 139812322) is prop-2-enyl piperidine-1-carboxylate;hydrochloride.
What is the SMILES notation for prop-2-enyl piperidine-1-carboxylate;hydrochloride?
The canonical SMILES for prop-2-enyl piperidine-1-carboxylate;hydrochloride is C=CCOC(=O)N1CCCCC1.Cl.
What is the InChIKey of prop-2-enyl piperidine-1-carboxylate;hydrochloride?
The InChIKey is VVWMXZJTDHQVSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.ClH/c1-2-8-12-9(11)10-6-4-3-5-7-10;/h2H,1,3-8H2;1H.
What are the key properties of prop-2-enyl piperidine-1-carboxylate;hydrochloride?
prop-2-enyl piperidine-1-carboxylate;hydrochloride has a molecular weight of 205.68 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl piperidine-1-carboxylate;hydrochloride is sourced from PubChem (CID 139812322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).