About prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate
prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate (PubChem CID 70521278) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate |
| PubChem CID | 70521278 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCN1C(N)=O |
| InChI | InChI=1S/C8H13N3O3/c1-2-6-14-8(13)11-5-3-4-10(11)7(9)12/h2H,1,3-6H2,(H2,9,12) |
| InChIKey | ABYAWGWFCQZHFQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate?
The IUPAC name of prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate (CID 70521278) is prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate is C=CCOC(=O)N1CCCN1C(N)=O.
What is the InChIKey of prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate?
The InChIKey is ABYAWGWFCQZHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-2-6-14-8(13)11-5-3-4-10(11)7(9)12/h2H,1,3-6H2,(H2,9,12).
What are the key properties of prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate?
prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate has a molecular weight of 199.21 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-carbamoylpyrazolidine-1-carboxylate is sourced from PubChem (CID 70521278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).