C12H19NO2 — CID 141053851
prop-2-enyl 2-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 141053851) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is prop-2-enyl 2-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | prop-2-enyl 2-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 141053851 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | prop-2-enyl 2-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC=CCC1C(C)C |
| InChI | InChI=1S/C12H19NO2/c1-4-9-15-12(14)13-8-6-5-7-11(13)10(2)3/h4-6,10-11H,1,7-9H2,2-3H3 |
| InChIKey | XVBKDFBJXSPMRD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|