C15H20N2O2S2 — CID 91112859
prop-2-enyl (6R)-6-propan-2-yl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 91112859) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is prop-2-enyl (6R)-6-propan-2-yl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | prop-2-enyl (6R)-6-propan-2-yl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 91112859 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | prop-2-enyl (6R)-6-propan-2-yl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(c2csc(=S)[nH]2)=C[C@H]1C(C)C |
| InChI | InChI=1S/C15H20N2O2S2/c1-4-7-19-15(18)17-6-5-11(8-13(17)10(2)3)12-9-21-14(20)16-12/h4,8-10,13H,1,5-7H2,2-3H3,(H,16,20)/t13-/m0/s1 |
| InChIKey | FALMLARHSBHFKK-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|