C13H16N2O3S2 — CID 86592510
prop-2-enyl (2S)-2-(hydroxymethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 86592510) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(hydroxymethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | prop-2-enyl (2S)-2-(hydroxymethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86592510 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | prop-2-enyl (2S)-2-(hydroxymethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC=C(c2csc(=S)[nH]2)C[C@H]1CO |
| InChI | InChI=1S/C13H16N2O3S2/c1-2-5-18-13(17)15-4-3-9(6-10(15)7-16)11-8-20-12(19)14-11/h2-3,8,10,16H,1,4-7H2,(H,14,19)/t10-/m0/s1 |
| InChIKey | LDYSVPBCYGQFFH-JTQLQIEISA-N |
| XLogP | 2.58 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|