C11H14N2O2S2 — CID 11021968
prop-2-enyl (2R)-2-(4-sulfanyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 11021968) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-(4-sulfanyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R)-2-(4-sulfanyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11021968 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | prop-2-enyl (2R)-2-(4-sulfanyl-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@@H]1c1nc(S)cs1 |
| InChI | InChI=1S/C11H14N2O2S2/c1-2-6-15-11(14)13-5-3-4-8(13)10-12-9(16)7-17-10/h2,7-8,16H,1,3-6H2/t8-/m1/s1 |
| InChIKey | MNCZTJWVTKYTOT-MRVPVSSYSA-N |
| XLogP | 2.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|