C10H15NO3 — CID 153289748
prop-2-enyl 2-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 153289748) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is prop-2-enyl 2-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | prop-2-enyl 2-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 153289748 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | prop-2-enyl 2-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC=CCC1OC |
| InChI | InChI=1S/C10H15NO3/c1-3-8-14-10(12)11-7-5-4-6-9(11)13-2/h3-5,9H,1,6-8H2,2H3 |
| InChIKey | NTBNURZQSIVDMU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|