C14H21NO4 — CID 57315470
prop-2-enyl (2S,4R)-4-methoxy-2-(2-methyl-3-oxobut-1-enyl)pyrrolidine-1-carboxylate (PubChem CID 57315470) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-methoxy-2-(2-methyl-3-oxobut-1-enyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-methoxy-2-(2-methyl-3-oxobut-1-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57315470 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-methoxy-2-(2-methyl-3-oxobut-1-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OC)C[C@H]1C=C(C)C(C)=O |
| InChI | InChI=1S/C14H21NO4/c1-5-6-19-14(17)15-9-13(18-4)8-12(15)7-10(2)11(3)16/h5,7,12-13H,1,6,8-9H2,2-4H3/t12-,13-/m1/s1 |
| InChIKey | IJOBMMKMYDDRHP-CHWSQXEVSA-N |
| XLogP | 1.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|