C15H24N2O5S2 — CID 173348159
prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(3-amino-2-methyl-3-methylsulfonylprop-1-enyl)pyrrolidine-1-carboxylate (PubChem CID 173348159) has the molecular formula C15H24N2O5S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(3-amino-2-methyl-3-methylsulfonylprop-1-enyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(3-amino-2-methyl-3-methylsulfonylprop-1-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173348159 |
| Molecular Formula | C15H24N2O5S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | prop-2-enyl (2S,4S)-4-acetylsulfanyl-2-(3-amino-2-methyl-3-methylsulfonylprop-1-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(C)=O)C[C@H]1C=C(C)C(N)S(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O5S2/c1-5-6-22-15(19)17-9-13(23-11(3)18)8-12(17)7-10(2)14(16)24(4,20)21/h5,7,12-14H,1,6,8-9,16H2,2-4H3/t12-,13+,14?/m1/s1 |
| InChIKey | HWQUPZSEXRHNBJ-AMIUJLCOSA-N |
| XLogP | 1.31 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|