C18H27N3O6S — CID 86749745
prop-2-enyl (2S,4S)-2-[2-(3-acetamidoprop-1-en-2-yloxycarbonylamino)ethyl]-4-acetylsulfanylpyrrolidine-1-carboxylate (PubChem CID 86749745) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[2-(3-acetamidoprop-1-en-2-yloxycarbonylamino)ethyl]-4-acetylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[2-(3-acetamidoprop-1-en-2-yloxycarbonylamino)ethyl]-4-acetylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86749745 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[2-(3-acetamidoprop-1-en-2-yloxycarbonylamino)ethyl]-4-acetylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(C)=O)C[C@@H]1CCNC(=O)OC(=C)CNC(C)=O |
| InChI | InChI=1S/C18H27N3O6S/c1-5-8-26-18(25)21-11-16(28-14(4)23)9-15(21)6-7-19-17(24)27-12(2)10-20-13(3)22/h5,15-16H,1-2,6-11H2,3-4H3,(H,19,24)(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | QGSBWGBKEXDEPQ-HOTGVXAUSA-N |
| XLogP | 1.80 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|