C22H30N2O7S2 — CID 59048594
prop-2-enyl (2S,4S)-2-[[(5-ethoxycarbonylthiophene-2-carbonyl)amino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 59048594) has the molecular formula C22H30N2O7S2 and a molecular weight of 498.62 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[[(5-ethoxycarbonylthiophene-2-carbonyl)amino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[[(5-ethoxycarbonylthiophene-2-carbonyl)amino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59048594 |
| Molecular Formula | C22H30N2O7S2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[[(5-ethoxycarbonylthiophene-2-carbonyl)amino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(=O)OC(C)(C)C)C[C@H]1CNC(=O)c1ccc(C(=O)OCC)s1 |
| InChI | InChI=1S/C22H30N2O7S2/c1-6-10-30-20(27)24-13-15(32-21(28)31-22(3,4)5)11-14(24)12-23-18(25)16-8-9-17(33-16)19(26)29-7-2/h6,8-9,14-15H,1,7,10-13H2,2-5H3,(H,23,25)/t14-,15-/m0/s1 |
| InChIKey | HWUJATABOZXDOL-GJZGRUSLSA-N |
| XLogP | 4.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|