C17H25NO4S — CID 86702006
tert-butyl 4-(5-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate (PubChem CID 86702006) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is tert-butyl 4-(5-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86702006 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl 4-(5-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(C2CCN(C(=O)OC(C)(C)C)CC2)s1 |
| InChI | InChI=1S/C17H25NO4S/c1-5-21-15(19)14-7-6-13(23-14)12-8-10-18(11-9-12)16(20)22-17(2,3)4/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | QYMHCOJOFFQUBF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |