C17H24ClNO4S — CID 178075880
tert-butyl 4-(5-chloro-3-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate (PubChem CID 178075880) has the molecular formula C17H24ClNO4S and a molecular weight of 373.90 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-3-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-3-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178075880 |
| Molecular Formula | C17H24ClNO4S |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | tert-butyl 4-(5-chloro-3-ethoxycarbonylthiophen-2-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)sc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H24ClNO4S/c1-5-22-15(20)12-10-13(18)24-14(12)11-6-8-19(9-7-11)16(21)23-17(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | OESVKQSCPROWSK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |