C15H21ClN2O3S — CID 58780660
tert-butyl 4-(3-acetyl-5-chlorothiophen-2-yl)piperazine-1-carboxylate (PubChem CID 58780660) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is tert-butyl 4-(3-acetyl-5-chlorothiophen-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-acetyl-5-chlorothiophen-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58780660 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | tert-butyl 4-(3-acetyl-5-chlorothiophen-2-yl)piperazine-1-carboxylate |
| SMILES | CC(=O)c1cc(Cl)sc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-10(19)11-9-12(16)22-13(11)17-5-7-18(8-6-17)14(20)21-15(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | NEQUBZMVTQOXTM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |