C34H45N3O7S2 — CID 22986128
prop-2-enyl 2-[[3-benzyl-4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)carbamoyl]anilino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 22986128) has the molecular formula C34H45N3O7S2 and a molecular weight of 671.88 g/mol. Its IUPAC name is prop-2-enyl 2-[[3-benzyl-4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)carbamoyl]anilino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-[[3-benzyl-4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)carbamoyl]anilino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22986128 |
| Molecular Formula | C34H45N3O7S2 |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | prop-2-enyl 2-[[3-benzyl-4-[(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)carbamoyl]anilino]methyl]-4-[(2-methylpropan-2-yl)oxycarbonylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(SC(=O)OC(C)(C)C)CC1CNc1ccc(C(=O)NC(CCSC)C(=O)OC)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C34H45N3O7S2/c1-7-16-43-32(40)37-22-27(46-33(41)44-34(2,3)4)20-26(37)21-35-25-13-14-28(24(19-25)18-23-11-9-8-10-12-23)30(38)36-29(15-17-45-6)31(39)42-5/h7-14,19,26-27,29,35H,1,15-18,20-22H2,2-6H3,(H,36,38) |
| InChIKey | FDYGWBHOQPXUGU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|