C24H28N3O5S2- — CID 22321858
2-[[2-benzyl-4-[(3-sulfonylpyrrolidin-2-yl)methylamino]benzoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 22321858) has the molecular formula C24H28N3O5S2- and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-[[2-benzyl-4-[(3-sulfonylpyrrolidin-2-yl)methylamino]benzoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | 2-[[2-benzyl-4-[(3-sulfonylpyrrolidin-2-yl)methylamino]benzoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 22321858 |
| Molecular Formula | C24H28N3O5S2- |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-[[2-benzyl-4-[(3-sulfonylpyrrolidin-2-yl)methylamino]benzoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccc(NCC2NCCC2=S(=O)=O)cc1Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C24H29N3O5S2/c1-33-12-10-20(24(29)30)27-23(28)19-8-7-18(14-17(19)13-16-5-3-2-4-6-16)26-15-21-22(34(31)32)9-11-25-21/h2-8,14,20-21,25-26H,9-13,15H2,1H3,(H,27,28)(H,29,30)/p-1 |
| InChIKey | OUIZRYRGEYTMIU-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|