C24H31N3O3S2 — CID 87983864
(2S)-2-[[2-benzyl-4-[methyl-(3-sulfanylpyrrolidin-2-yl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 87983864) has the molecular formula C24H31N3O3S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is (2S)-2-[[2-benzyl-4-[methyl-(3-sulfanylpyrrolidin-2-yl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-benzyl-4-[methyl-(3-sulfanylpyrrolidin-2-yl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 87983864 |
| Molecular Formula | C24H31N3O3S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (2S)-2-[[2-benzyl-4-[methyl-(3-sulfanylpyrrolidin-2-yl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(N(C)C2NCCC2S)cc1Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H31N3O3S2/c1-27(22-21(31)10-12-25-22)18-8-9-19(17(15-18)14-16-6-4-3-5-7-16)23(28)26-20(24(29)30)11-13-32-2/h3-9,15,20-22,25,31H,10-14H2,1-2H3,(H,26,28)(H,29,30)/t20-,21?,22?/m0/s1 |
| InChIKey | PTFIDSRPBDXKBU-HWELCPFYSA-N |
| XLogP | 3.27 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|