C21H33N3O4S2 — CID 87990306
(2S)-2-[[3-[3-methoxypropyl-[(3-sulfanylpyrrolidin-2-yl)methyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 87990306) has the molecular formula C21H33N3O4S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is (2S)-2-[[3-[3-methoxypropyl-[(3-sulfanylpyrrolidin-2-yl)methyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[3-[3-methoxypropyl-[(3-sulfanylpyrrolidin-2-yl)methyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 87990306 |
| Molecular Formula | C21H33N3O4S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2S)-2-[[3-[3-methoxypropyl-[(3-sulfanylpyrrolidin-2-yl)methyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | COCCCN(CC1NCCC1S)c1cccc(C(=O)N[C@@H](CCSC)C(=O)O)c1 |
| InChI | InChI=1S/C21H33N3O4S2/c1-28-11-4-10-24(14-18-19(29)7-9-22-18)16-6-3-5-15(13-16)20(25)23-17(21(26)27)8-12-30-2/h3,5-6,13,17-19,22,29H,4,7-12,14H2,1-2H3,(H,23,25)(H,26,27)/t17-,18?,19?/m0/s1 |
| InChIKey | BBBVBUPKQNGDBK-VIQWUECVSA-N |
| XLogP | 2.13 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|