C13H16NO4S- — CID 2451201
(2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 2451201) has the molecular formula C13H16NO4S- and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2451201 |
| Molecular Formula | C13H16NO4S- |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccccc1C(=O)N[C@H](CCSC)C(=O)[O-] |
| InChI | InChI=1S/C13H17NO4S/c1-18-11-6-4-3-5-9(11)12(15)14-10(13(16)17)7-8-19-2/h3-6,10H,7-8H2,1-2H3,(H,14,15)(H,16,17)/p-1/t10-/m1/s1 |
| InChIKey | DHVHARWVSABRLB-SNVBAGLBSA-M |
| XLogP | 0.30 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |