C21H25FN2O4S — CID 43062435
N-[1-[2-(4-fluorophenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide (PubChem CID 43062435) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[1-[2-(4-fluorophenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide.
| Compound Name | N-[1-[2-(4-fluorophenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 43062435 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[1-[2-(4-fluorophenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(CCSC)C(=O)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O4S/c1-27-19-6-4-3-5-17(19)20(25)24-18(11-14-29-2)21(26)23-12-13-28-16-9-7-15(22)8-10-16/h3-10,18H,11-14H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | XAUCIFJJBGEYRW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|