C20H22ClN3O4S — CID 46651561
N-[1-[2-(4-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide (PubChem CID 46651561) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is N-[1-[2-(4-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide.
| Compound Name | N-[1-[2-(4-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46651561 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-[1-[2-(4-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(CCSC)C(=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-28-17-6-4-3-5-15(17)19(26)22-16(11-12-29-2)20(27)24-23-18(25)13-7-9-14(21)10-8-13/h3-10,16H,11-12H2,1-2H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | DYVMAPXHPDUZCN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|