C20H19ClF3N3O3S — CID 2819863
N-[1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 2819863) has the molecular formula C20H19ClF3N3O3S and a molecular weight of 473.90 g/mol. Its IUPAC name is N-[1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2819863 |
| Molecular Formula | C20H19ClF3N3O3S |
| Molecular Weight | 473.90 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(C(F)(F)F)cc1)C(=O)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H19ClF3N3O3S/c1-31-11-10-16(19(30)27-26-18(29)14-4-2-3-5-15(14)21)25-17(28)12-6-8-13(9-7-12)20(22,23)24/h2-9,16H,10-11H2,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | VAKCYNFVYFLPSG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|