C15H10ClF3N2O2 — CID 35932014
2-chloro-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide (PubChem CID 35932014) has the molecular formula C15H10ClF3N2O2 and a molecular weight of 342.70 g/mol. Its IUPAC name is 2-chloro-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 35932014 |
| Molecular Formula | C15H10ClF3N2O2 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-chloro-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10ClF3N2O2/c16-12-4-2-1-3-11(12)14(23)21-20-13(22)9-5-7-10(8-6-9)15(17,18)19/h1-8H,(H,20,22)(H,21,23) |
| InChIKey | ASCNFGBFCAJYJC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|